|
CAS#: 10169-34-3 Product: Mitomycin D No suppilers available for the product. |
| Name | Mitomycin D |
|---|---|
| Synonyms | Brn 4720574; Mitomycin D |
| Molecular Structure | ![]() |
| Molecular Formula | C15H18N4O5 |
| Molecular Weight | 334.33 |
| CAS Registry Number | 10169-34-3 |
| SMILES | [C@@]13(N(C2=C([C@H]1COC(N)=O)C(C(=C(C2=O)C)N)=O)CC4C3N4C)O |
| InChI | 1S/C15H18N4O5/c1-5-9(16)12(21)8-6(4-24-14(17)22)15(23)13-7(18(13)2)3-19(15)10(8)11(5)20/h6-7,13,23H,3-4,16H2,1-2H3,(H2,17,22)/t6-,7?,13?,15-,18?/m1/s1 |
| InChIKey | JHIATKDBEBOOCO-WWKFOGPPSA-N |
| Density | 1.64g/cm3 (Cal.) |
|---|---|
| Boiling point | 601.703°C at 760 mmHg (Cal.) |
| Flash point | 317.699°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Mitomycin D |