Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3,4-Dihydroxyphenyl Methanesulfonate |
|---|---|
| Synonyms | 3,4-dihydroxyphenyl methanesulfonate |
| Molecular Structure |  |
| Molecular Formula | C7H8O5S |
| Molecular Weight | 204.20 |
| CAS Registry Number | 101959-14-2 |
| SMILES | CS(=O)(=O)Oc1ccc(c(c1)O)O |
| InChI | 1S/C7H8O5S/c1-13(10,11)12-5-2-3-6(8)7(9)4-5/h2-4,8-9H,1H3 |
| InChIKey | WRJAZMKKGCVUAP-UHFFFAOYSA-N |
| Density | 1.555g/cm3 (Cal.) |
|---|---|
| Boiling point | 434.95°C at 760 mmHg (Cal.) |
| Flash point | 216.85°C (Cal.) |
| Refractive index | 1.601 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4-Dihydroxyphenyl Methanesulfonate |