Online Database of Chemicals from Around the World
|
CAS#: 71573-09-6 Product: N-(3,4-Dihydroxyphenyl)Maleimide No suppilers available for the product. |
| Name | N-(3,4-Dihydroxyphenyl)Maleimide |
|---|---|
| Synonyms | 1-(3,4-Dihydroxyphenyl)-3-Pyrroline-2,5-Quinone; 1H-Pyrrole-2,5-Dione, 1-(3,4-Dihydroxyphenyl)-; 3,4-Dhpml |
| Molecular Structure |  |
| Molecular Formula | C10H7NO4 |
| Molecular Weight | 205.17 |
| CAS Registry Number | 71573-09-6 |
| SMILES | C1=C(O)C(=CC=C1N2C(=O)C=CC2=O)O |
| InChI | 1S/C10H7NO4/c12-7-2-1-6(5-8(7)13)11-9(14)3-4-10(11)15/h1-5,12-13H |
| InChIKey | POKCOZFAKCBKCD-UHFFFAOYSA-N |
| Density | 1.614g/cm3 (Cal.) |
|---|---|
| Boiling point | 480.282°C at 760 mmHg (Cal.) |
| Flash point | 244.266°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(3,4-Dihydroxyphenyl)Maleimide |