| Florida Center for Heterocyclic Compounds | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (352) 392-0554 | |||
![]() |
katritzky@chem.ufl.edu | |||
| Chemical manufacturer | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Phenylalanine derivatives |
|---|---|
| Name | Dicyclohexylammonium 2-(tert-butoxycarbonylamino)-3-(4-nitrophenyl)propanoate |
| Synonyms | Boc-4-nitro-L-phenylalanine dicyclohexylammonium salt |
| Molecular Structure | ![]() |
| Molecular Formula | C26H41N3O6 |
| Molecular Weight | 491.62 |
| CAS Registry Number | 102185-42-2 |
| SMILES | [O-]C(=O)C(NC(=O)OC(C)(C)C)Cc1ccc(cc1)[N+]([O-])=O.C1CCCCC1[NH2+]C2CCCCC2 |
| InChI | 1S/C14H18N2O6.C12H23N/c1-14(2,3)22-13(19)15-11(12(17)18)8-9-4-6-10(7-5-9)16(20)21;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h4-7,11H,8H2,1-3H3,(H,15,19)(H,17,18);11-13H,1-10H2 |
| InChIKey | LVBPPXVRTJXZEU-UHFFFAOYSA-N |
| Boiling point | 660.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 353.3°C (Cal.) |
| Refractive index | (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Dicyclohexylammonium 2-(tert-butoxycarbonylamino)-3-(4-nitrophenyl)propanoate |