Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Dicyclohexylamine Sulfate |
|---|---|
| Synonyms | Cyclohexylamine, Sulfate (2:1); Cyclohexylammonium Sulphate (2:1) |
| Molecular Structure |  |
| Molecular Formula | C12H28N2O4S |
| Molecular Weight | 296.42 |
| CAS Registry Number | 73254-20-3 (17911-61-4) |
| EINECS | 241-855-1 |
| SMILES | O=[S](O)(O)=O.C1C(CCCC1)N.C2C(CCCC2)N |
| InChI | 1S/2C6H13N.H2O4S/c2*7-6-4-2-1-3-5-6;1-5(2,3)4/h2*6H,1-5,7H2;(H2,1,2,3,4) |
| InChIKey | WZBMSCFCEJIJSE-UHFFFAOYSA-N |
| Boiling point | 134.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 32.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dicyclohexylamine Sulfate |