Online Database of Chemicals from Around the World
| Florida Center for Heterocyclic Compounds | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (352) 392-0554 | |||
 |
katritzky@chem.ufl.edu | |||
| Chemical manufacturer | ||||
| Name | 2-Butyl-1-Phenylbutane-1,3-Dione |
|---|---|
| Synonyms | 2-Butyl-1-Phenyl-Butane-1,3-Dione; 1,3-Butanedione, 2-Butyl-1-Phenyl-; Nsc406960 |
| Molecular Structure |  |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 |
| CAS Registry Number | 10225-39-5 |
| SMILES | C1=CC=C(C=C1)C(=O)C(C(=O)C)CCCC |
| InChI | 1S/C14H18O2/c1-3-4-10-13(11(2)15)14(16)12-8-6-5-7-9-12/h5-9,13H,3-4,10H2,1-2H3 |
| InChIKey | UHORPYVBTFVDPA-UHFFFAOYSA-N |
| Density | 1.004g/cm3 (Cal.) |
|---|---|
| Boiling point | 320.816°C at 760 mmHg (Cal.) |
| Flash point | 120.158°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Butyl-1-Phenylbutane-1,3-Dione |