|
CAS#: 102441-39-4 Product: 2-Phenyl-2-(2-Phenyl-1H-Indol-3-Yl)Ethanamine Hydrochloride No suppilers available for the product. |
| Name | 2-Phenyl-2-(2-Phenyl-1H-Indol-3-Yl)Ethanamine Hydrochloride |
|---|---|
| Synonyms | [(2S)-2-Phenyl-2-(2-Phenyl-1H-Indol-3-Yl)Ethyl]Ammonium; Zinc03319631 |
| Molecular Structure | ![]() |
| Molecular Formula | C22H21N2 |
| Molecular Weight | 313.42 |
| CAS Registry Number | 102441-39-4 |
| SMILES | [C@@H](C1=C([NH]C2=C1C=CC=C2)C3=CC=CC=C3)(C4=CC=CC=C4)C[NH3+] |
| InChI | 1S/C22H20N2/c23-15-19(16-9-3-1-4-10-16)21-18-13-7-8-14-20(18)24-22(21)17-11-5-2-6-12-17/h1-14,19,24H,15,23H2/p+1/t19-/m0/s1 |
| InChIKey | VWDKTWOKEKGMSJ-IBGZPJMESA-O |
| Boiling point | 542.656°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 315.777°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Phenyl-2-(2-Phenyl-1H-Indol-3-Yl)Ethanamine Hydrochloride |