Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | (E)-1-Phenyl-2-[(Z)-(Phenylhydrazono)(2-Thienyl)Methyl]Diazene |
|---|---|
| Synonyms | 1,5-Diphenyl-3-(2-thienyl)formazan |
| Molecular Structure | ![CAS#: 135984-01-9， (E)-1-Phenyl-2-[(Z)-(Phenylhydrazono)(2-Thienyl)Methyl]Diazene](/moreStructures/135984-01-9.gif) |
| Molecular Formula | C17H14N4S |
| Molecular Weight | 306.38 |
| CAS Registry Number | 135984-01-9 |
| SMILES | c1ccc(cc1)N/N=C(/c2cccs2)\N=N\c3ccccc3 |
| InChI | 1S/C17H14N4S/c1-3-8-14(9-4-1)18-20-17(16-12-7-13-22-16)21-19-15-10-5-2-6-11-15/h1-13,18H/b20-17-,21-19+ |
| InChIKey | YYNVZGCGVPELJN-ZJTHLCGRSA-N |
| Density | 1.206g/cm3 (Cal.) |
|---|---|
| Melting point | 144°C (Expl.) |
| Boiling point | 449.836°C at 760 mmHg (Cal.) |
| Flash point | 225.853°C (Cal.) |
| Refractive index | 1.655 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (E)-1-Phenyl-2-[(Z)-(Phenylhydrazono)(2-Thienyl)Methyl]Diazene |