Online Database of Chemicals from Around the World
|
CAS#: 102490-01-7 Product: 16-Episarpagine No suppilers available for the product. |
| Name | 16-Episarpagine |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 |
| CAS Registry Number | 102490-01-7 |
| SMILES | [C@H]13N2[C@H](C(C(C1)C(/C2)=C\C)CO)CC4=C3[NH]C5=CC=C(O)C=C45 |
| InChI | 1S/C19H22N2O2/c1-2-10-8-21-17-7-14-13-5-11(23)3-4-16(13)20-19(14)18(21)6-12(10)15(17)9-22/h2-5,12,15,17-18,20,22-23H,6-9H2,1H3/b10-2-/t12?,15?,17-,18-/m0/s1 |
| InChIKey | VTVQHYQGTTVKDE-LUMHSOHMSA-N |
| Density | 1.39g/cm3 (Cal.) |
|---|---|
| Boiling point | 524.612°C at 760 mmHg (Cal.) |
| Flash point | 271.076°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 16-Episarpagine |