Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Interchim Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (800) 560-8262 | |||
|
web@interchiminc.com | |||
| Chemical manufacturer | ||||
| Name | 4,4'-[(E)-1,2-Diazenediyl]Dibenzoyl Chloride |
|---|---|
| Synonyms | 4,4-Azodibenzoyl Dichloride; 4,4'-AZODIBENZOYL DICHLORIDE; Azobenzene-4,4'-dicarbonyl Dichloride |
| Molecular Structure | ![CAS#: 10252-29-6， 4,4'-[(E)-1,2-Diazenediyl]Dibenzoyl Chloride](/moreStructures/10252-29-6.gif) |
| Molecular Formula | C14H8Cl2N2O2 |
| Molecular Weight | 307.13 |
| CAS Registry Number | 10252-29-6 |
| SMILES | ClC(=O)c2ccc(/N=N/c1ccc(cc1)C(Cl)=O)cc2 |
| InChI | 1S/C14H8Cl2N2O2/c15-13(19)9-1-5-11(6-2-9)17-18-12-7-3-10(4-8-12)14(16)20/h1-8H/b18-17+ |
| InChIKey | ASOXKYGOZZTVHL-ISLYRVAYSA-N |
| Density | 1.374g/cm3 (Cal.) |
|---|---|
| Melting point | 164°C (Expl.) |
| Boiling point | 458.628°C at 760 mmHg (Cal.) |
| Flash point | 183.445°C (Cal.) |
| Refractive index | 1.624 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4,4'-[(E)-1,2-Diazenediyl]Dibenzoyl Chloride |