| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2,2'-[(E)-1,2-Diazenediyl]bis(1H-imidazole) |
|---|---|
| Synonyms | (E)-1,2-di(1H-imidazol-2-yl)diazene; azoimidazole |
| Molecular Structure | ![]() |
| Molecular Formula | C6H6N6 |
| CAS Registry Number | 875825-96-0 |
| SMILES | C1=CN=C(N1)/N=N/C2=NC=CN2 |
| InChI | 1S/C6H6N6/c1-2-8-5(7-1)11-12-6-9-3-4-10-6/h1-4H,(H,7,8)(H,9,10)/b12-11+ |
| InChIKey | MJKDQDZHUIFGLN-VAWYXSNFSA-N |
| Refractive index | (Cal.) |
|---|---|
| (1) | Indranil Chakraborty, Suman Sengupta, Samir Das, Sangeeta Banerjee and Animesh Chakravorty. Chemistry of monovalent and bivalent rhenium: synthesis, structure, isomer specificity and metal redox of azoheterocycle complexes, Dalton Trans., 2003, 0, 134. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,2'-[(E)-1,2-Diazenediyl]bis(1H-imidazole) |