|
CAS#: 10257-35-9 Product: D-Lyxopyranose No suppilers available for the product. |
| Name | D-Lyxopyranose |
|---|---|
| Synonyms | (3S,4S,5R)-tetrahydro-2H-pyran-2,3,4,5-tetraol; D-(-)-Lyxose; D-(−)-Lyxose |
| Molecular Structure | ![]() |
| Molecular Formula | C5H10O5 |
| Molecular Weight | 150.13 |
| CAS Registry Number | 10257-35-9 |
| SMILES | O[C@H]1[C@H](O)COC(O)[C@H]1O |
| InChI | 1S/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3+,4+,5?/m1/s1 |
| InChIKey | SRBFZHDQGSBBOR-AGQMPKSLSA-N |
| Density | 1.757g/cm3 (Cal.) |
|---|---|
| Boiling point | 333.164°C at 760 mmHg (Cal.) |
| Flash point | 155.292°C (Cal.) |
| Refractive index | 1.646 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for D-Lyxopyranose |