Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | beta-L-Lyxopyranose |
|---|---|
| Synonyms | (2S,3R,4R,5S)-tetrahydro-2H-pyran-2,3,4,5-tetraol; pentopyranose; ZINC01532669 |
| Molecular Structure |  |
| Molecular Formula | C5H10O5 |
| Molecular Weight | 150.13 |
| CAS Registry Number | 7283-07-0 |
| SMILES | O[C@@H]1[C@@H](O)CO[C@H](O)[C@@H]1O |
| InChI | 1S/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3+,4+,5-/m0/s1 |
| InChIKey | SRBFZHDQGSBBOR-RSJOWCBRSA-N |
| Density | 1.757g/cm3 (Cal.) |
|---|---|
| Boiling point | 333.164°C at 760 mmHg (Cal.) |
| Flash point | 155.292°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for beta-L-Lyxopyranose |