Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | N-1-Naphthylsulfuric Diamide |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C10H10N2O2S |
| Molecular Weight | 222.26 |
| CAS Registry Number | 103040-94-4 |
| SMILES | NS(=O)(=O)Nc2cccc1ccccc12 |
| InChI | 1S/C10H10N2O2S/c11-15(13,14)12-10-7-3-5-8-4-1-2-6-9(8)10/h1-7,12H,(H2,11,13,14) |
| InChIKey | JATQZZUDUITMMX-UHFFFAOYSA-N |
| Density | 1.47g/cm3 (Cal.) |
|---|---|
| Boiling point | 438.376°C at 760 mmHg (Cal.) |
| Flash point | 218.922°C (Cal.) |
| Refractive index | 1.73 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-1-Naphthylsulfuric Diamide |