Online Database of Chemicals from Around the World
| Princeton BioMolecular Research, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (732) 355-9920 | |||
 |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | 4-(2-Naphthylthioacetyl)Morpholine |
|---|---|
| Synonyms | 1-Morpholino-2-(2-Naphthyl)Ethanethione; 1-Morpholin-4-Yl-2-Naphthalen-2-Yl-Ethanethione; Morpholine, 4-(Beta-Naphthylthioacetyl)- |
| Molecular Structure |  |
| Molecular Formula | C16H17NOS |
| Molecular Weight | 271.38 |
| CAS Registry Number | 5399-06-4 |
| SMILES | C1=CC=C2C(=C1)C=C(C=C2)CC(=S)N3CCOCC3 |
| InChI | 1S/C16H17NOS/c19-16(17-7-9-18-10-8-17)12-13-5-6-14-3-1-2-4-15(14)11-13/h1-6,11H,7-10,12H2 |
| InChIKey | WZNVFYJKLFXPFP-UHFFFAOYSA-N |
| Density | 1.22g/cm3 (Cal.) |
|---|---|
| Boiling point | 443.99°C at 760 mmHg (Cal.) |
| Flash point | 222.317°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(2-Naphthylthioacetyl)Morpholine |