Online Database of Chemicals from Around the World
| Princeton BioMolecular Research, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (732) 355-9920 | |||
 |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | 4-Methylphenyl Diphenylcarbamate |
|---|---|
| Synonyms | 4-Methylphenyl diphenylcarbamate # |
| Molecular Structure |  |
| Molecular Formula | C20H17NO2 |
| Molecular Weight | 303.35 |
| CAS Registry Number | 10369-97-8 |
| SMILES | O=C(Oc1ccc(cc1)C)N(c2ccccc2)c3ccccc3 |
| InChI | 1S/C20H17NO2/c1-16-12-14-19(15-13-16)23-20(22)21(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-15H,1H3 |
| InChIKey | ODVSOHSQPJFLHN-UHFFFAOYSA-N |
| Density | 1.186g/cm3 (Cal.) |
|---|---|
| Boiling point | 430.171°C at 760 mmHg (Cal.) |
| Flash point | 213.96°C (Cal.) |
| Refractive index | 1.634 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methylphenyl Diphenylcarbamate |