Online Database of Chemicals from Around the World
|
CAS#: 87848-97-3 Product: 6-[2-(4-Methylphenyl)-1,3-dioxolan-2-yl]-2-pyridinecarbaldehyde No suppilers available for the product. |
| Name | 6-[2-(4-Methylphenyl)-1,3-dioxolan-2-yl]-2-pyridinecarbaldehyde |
|---|---|
| Synonyms | 6-[2-(p-tolyl)-1,3-dioxolan-2-yl]pyridine-2-carbaldehyde |
| Molecular Structure | ![CAS#: 87848-97-3， 6-[2-(4-Methylphenyl)-1,3-dioxolan-2-yl]-2-pyridinecarbaldehyde](/moreStructures/87848-97-3.gif) |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 |
| CAS Registry Number | 87848-97-3 |
| EINECS | 289-352-6 |
| SMILES | O=Cc1nc(ccc1)C2(OCCO2)c3ccc(cc3)C |
| InChI | 1S/C16H15NO3/c1-12-5-7-13(8-6-12)16(19-9-10-20-16)15-4-2-3-14(11-18)17-15/h2-8,11H,9-10H2,1H3 |
| InChIKey | NZHAUOLVIWXXBC-UHFFFAOYSA-N |
| Density | 1.231g/cm3 (Cal.) |
|---|---|
| Boiling point | 421.916°C at 760 mmHg (Cal.) |
| Flash point | 208.968°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-[2-(4-Methylphenyl)-1,3-dioxolan-2-yl]-2-pyridinecarbaldehyde |