|
CAS#: 10403-51-7 Product: Mitindomide No suppilers available for the product. |
| Name | Mitindomide |
|---|---|
| Synonyms | Nsc378692; Aids-015202; Aids015202 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H12N2O4 |
| Molecular Weight | 272.26 |
| CAS Registry Number | 10403-51-7 |
| SMILES | O=C2C1C4C(C1C(=O)N2)C5C3C(=O)NC(C3C4C=C5)=O |
| InChI | 1S/C14H12N2O4/c17-11-7-3-1-2-4(8(7)12(18)15-11)6-5(3)9-10(6)14(20)16-13(9)19/h1-10H,(H,15,17,18)(H,16,19,20) |
| InChIKey | DRCJGCOYHLTVNR-UHFFFAOYSA-N |
| Density | 1.519g/cm3 (Cal.) |
|---|---|
| Boiling point | 618.229°C at 760 mmHg (Cal.) |
| Flash point | 269.982°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Mitindomide |