Online Database of Chemicals from Around the World
|
CAS#: 104608-82-4 Product: 10-Ethyldithranol No suppilers available for the product. |
| Name | 10-Ethyldithranol |
|---|---|
| Synonyms | 10-Ethyldithranol; 9(10H)-Anthracenone, 10-Ethyl-1,8-Dihydroxy-; 1,8-Dihydroxy-10-Ethyl-9(10H)-Anthracenone |
| Molecular Structure |  |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28 |
| CAS Registry Number | 104608-82-4 |
| SMILES | C1=CC=C(O)C2=C1C(CC)C3=C(C2=O)C(=CC=C3)O |
| InChI | 1S/C16H14O3/c1-2-9-10-5-3-7-12(17)14(10)16(19)15-11(9)6-4-8-13(15)18/h3-9,17-18H,2H2,1H3 |
| InChIKey | HQHJGYHOFVZUIM-UHFFFAOYSA-N |
| Density | 1.291g/cm3 (Cal.) |
|---|---|
| Boiling point | 425.259°C at 760 mmHg (Cal.) |
| Flash point | 225.134°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 10-Ethyldithranol |