Online Database of Chemicals from Around the World
| Name | Ethyldithiophosphonic Acid O-Methyl S-Phenyl Ester |
|---|---|
| Synonyms | Ethyl-Methoxy-Phenylsulfanyl-Thioxo-Phosphorane; Ethyl-Methoxy-(Phenylthio)-Thioxophosphorane; Ethyl-Methoxy-(Phenylthio)-Thioxo-Phosphorane |
| Molecular Structure |  |
| Molecular Formula | C9H13OPS2 |
| Molecular Weight | 232.29 |
| CAS Registry Number | 2984-70-5 |
| SMILES | C1=C(S[P](=S)(OC)CC)C=CC=C1 |
| InChI | 1S/C9H13OPS2/c1-3-11(12,10-2)13-9-7-5-4-6-8-9/h4-8H,3H2,1-2H3 |
| InChIKey | BFHXKSJAKWIQQW-UHFFFAOYSA-N |
| Density | 1.198g/cm3 (Cal.) |
|---|---|
| Boiling point | 307.772°C at 760 mmHg (Cal.) |
| Flash point | 139.936°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyldithiophosphonic Acid O-Methyl S-Phenyl Ester |
