Online Database of Chemicals from Around the World
| Name | beta-Hydroxyphenethyl Acetate |
|---|---|
| Synonyms | (2-Hydroxy-2-Phenyl-Ethyl) Acetate; Acetic Acid (2-Hydroxy-2-Phenylethyl) Ester; Acetic Acid (2-Hydroxy-2-Phenyl-Ethyl) Ester |
| Molecular Structure |  |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 |
| CAS Registry Number | 10522-41-5 |
| EINECS | 234-072-1 |
| SMILES | C1=CC=C(C=C1)C(O)COC(=O)C |
| InChI | 1S/C10H12O3/c1-8(11)13-7-10(12)9-5-3-2-4-6-9/h2-6,10,12H,7H2,1H3 |
| InChIKey | QGJIFOZQMCBQIP-UHFFFAOYSA-N |
| Density | 1.148g/cm3 (Cal.) |
|---|---|
| Boiling point | 306.331°C at 760 mmHg (Cal.) |
| Flash point | 131.415°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for beta-Hydroxyphenethyl Acetate |
