Online Database of Chemicals from Around the World
|
CAS#: 18274-55-0 Product: 4-Hydroxyphenazine 5,10-Dioxide No suppilers available for the product. |
| Name | 4-Hydroxyphenazine 5,10-Dioxide |
|---|---|
| Synonyms | 5-Hydroxy-10-Oxido-Phenazin-10-Ium-1-One; 5-Hydroxy-10-Oxido-1-Phenazin-10-Iumone; 1-Phenazinol, 5,10-Dioxide |
| Molecular Structure |  |
| Molecular Formula | C12H8N2O3 |
| Molecular Weight | 228.21 |
| CAS Registry Number | 18274-55-0 |
| SMILES | C3=C2N(O)C1=CC=CC=C1[N+](=O)C2=C([O-])C=C3 |
| InChI | 1S/C12H8N2O3/c15-11-7-3-6-10-12(11)14(17)9-5-2-1-4-8(9)13(10)16/h1-7,16H |
| InChIKey | MVWCNCZRSYAPDY-UHFFFAOYSA-N |
| Density | 1.558g/cm3 (Cal.) |
|---|---|
| Boiling point | 502.043°C at 760 mmHg (Cal.) |
| Flash point | 257.426°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Hydroxyphenazine 5,10-Dioxide |