Online Database of Chemicals from Around the World
|
CAS#: 10550-79-5 Product: 1,1,2,2-Propanetetracarbonxamide No suppilers available for the product. |
| Name | 1,1,2,2-Propanetetracarbonxamide |
|---|---|
| Synonyms | 1,1,3,3-Propanetetracarboxamide; Nsc37690 |
| Molecular Structure |  |
| Molecular Formula | C7H12N4O4 |
| Molecular Weight | 216.20 |
| CAS Registry Number | 10550-79-5 |
| SMILES | C(C(C(N)=O)C(=O)N)C(C(=O)N)C(=O)N |
| InChI | 1S/C7H12N4O4/c8-4(12)2(5(9)13)1-3(6(10)14)7(11)15/h2-3H,1H2,(H2,8,12)(H2,9,13)(H2,10,14)(H2,11,15) |
| InChIKey | YITNVPBMLGVYIU-UHFFFAOYSA-N |
| Density | 1.461g/cm3 (Cal.) |
|---|---|
| Boiling point | 779.258°C at 760 mmHg (Cal.) |
| Flash point | 425.08°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,2,2-Propanetetracarbonxamide |