Online Database of Chemicals from Around the World
|
CAS#: 105528-04-9 Product: 1-(N-Ethyl-N-Nitrosamino)Ethyl Phosphate No suppilers available for the product. |
| Name | 1-(N-Ethyl-N-Nitrosamino)Ethyl Phosphate |
|---|---|
| Synonyms | 1-(Ethyl-Nitroso-Amino)Ethyl Dihydrogen Phosphate; 1-(N-Ethyl-N-Nitrosamino)Ethyl Phosphate; 1-Enep |
| Molecular Structure |  |
| Molecular Formula | C4H11N2O5P |
| Molecular Weight | 198.12 |
| CAS Registry Number | 105528-04-9 |
| SMILES | C(N(C(O[P](=O)(O)O)C)N=O)C |
| InChI | 1S/C4H11N2O5P/c1-3-6(5-7)4(2)11-12(8,9)10/h4H,3H2,1-2H3,(H2,8,9,10) |
| InChIKey | GMTUFHJJNHDDFA-UHFFFAOYSA-N |
| Density | 1.563g/cm3 (Cal.) |
|---|---|
| Boiling point | 413.482°C at 760 mmHg (Cal.) |
| Flash point | 203.867°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(N-Ethyl-N-Nitrosamino)Ethyl Phosphate |