Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Ethyl-3-nitroquinoline |
|---|---|
| Synonyms | 2-ethyl-3-nitroquinoline |
| Molecular Structure |  |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 |
| CAS Registry Number | 676998-17-7 |
| SMILES | [O-][N+](=O)c1cc2ccccc2nc1CC |
| InChI | 1S/C11H10N2O2/c1-2-9-11(13(14)15)7-8-5-3-4-6-10(8)12-9/h3-7H,2H2,1H3 |
| InChIKey | BJEOXPWZHDEDBC-UHFFFAOYSA-N |
| Density | 1.253g/cm3 (Cal.) |
|---|---|
| Boiling point | 310.319°C at 760 mmHg (Cal.) |
| Flash point | 141.476°C (Cal.) |
| Refractive index | 1.641 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Ethyl-3-nitroquinoline |