| Name | Methyl (2Z)-2-Acetamido-3-(4-Methoxyphenyl)Acrylate |
|---|---|
| Synonyms | (z)-methyl 2-acetamido-3-(4-methoxyphenyl)acrylate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.26 |
| CAS Registry Number | 105962-56-9 |
| SMILES | CC(=O)N/C(=C\c1ccc(cc1)OC)/C(=O)OC |
| InChI | 1S/C13H15NO4/c1-9(15)14-12(13(16)18-3)8-10-4-6-11(17-2)7-5-10/h4-8H,1-3H3,(H,14,15)/b12-8- |
| InChIKey | PLMBBMLMWFQODO-WQLSENKSSA-N |
| Density | 1.169g/cm3 (Cal.) |
|---|---|
| Boiling point | 476.011°C at 760 mmHg (Cal.) |
| Flash point | 241.683°C (Cal.) |
| Refractive index | 1.551 (Cal.) |
| (1) | Sigmund Duanne C. E.. Can the night-time atmospheric oxidant NO3˙ damage aromatic amino acids?, Chemical Communications, 2008 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Methyl (2Z)-2-Acetamido-3-(4-Methoxyphenyl)Acrylate |