Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Methyl 3-Acetamido-2-Hydroxybenzoate |
|---|---|
| Synonyms | methyl 3-acetamido-2-hydroxybenzoate |
| Molecular Structure |  |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 |
| CAS Registry Number | 184151-07-3 |
| SMILES | Oc1c(cccc1NC(C)=O)C(=O)OC |
| InChI | 1S/C10H11NO4/c1-6(12)11-8-5-3-4-7(9(8)13)10(14)15-2/h3-5,13H,1-2H3,(H,11,12) |
| InChIKey | FQERLORSROTTGU-UHFFFAOYSA-N |
| Density | 1.317g/cm3 (Cal.) |
|---|---|
| Boiling point | 370.667°C at 760 mmHg (Cal.) |
| Flash point | 177.973°C (Cal.) |
| Refractive index | 1.597 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 3-Acetamido-2-Hydroxybenzoate |