Online Database of Chemicals from Around the World
|
CAS#: 1062-71-1 Product: Methyl[Tris(Pentafluorophenyl)]Stannane No suppilers available for the product. |
| Name | Methyl[Tris(Pentafluorophenyl)]Stannane |
|---|---|
| Molecular Structure | ![CAS#: 1062-71-1， Methyl[Tris(Pentafluorophenyl)]Stannane](/moreStructures/1062-71-1.gif) |
| Molecular Formula | C19H3F15Sn |
| Molecular Weight | 634.91 |
| CAS Registry Number | 1062-71-1 |
| SMILES | Fc1c(c(F)c(F)c(F)c1F)[Sn](C)(c2c(F)c(F)c(F)c(F)c2F)c3c(F)c(F)c(F)c(F)c3F |
| InChI | 1S/3C6F5.CH3.Sn/c3*7-2-1-3(8)5(10)6(11)4(2)9;;/h;;;1H3; |
| InChIKey | ZDNZXKMCNCTLGN-UHFFFAOYSA-N |
| Boiling point | 380.858°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 184.137°C (Cal.) |
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl[Tris(Pentafluorophenyl)]Stannane |