Online Database of Chemicals from Around the World
|
CAS#: 66348-19-4 Product: Methyltris(Trifluoromethyl)Germane No suppilers available for the product. |
| Name | Methyltris(Trifluoromethyl)Germane |
|---|---|
| Synonyms | Methyltris(Trifluoromethyl)Germane |
| Molecular Structure |  |
| Molecular Formula | C4H3F9Ge |
| Molecular Weight | 294.64 |
| CAS Registry Number | 66348-19-4 |
| SMILES | C[Ge](C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | 1S/C4H3F9Ge/c1-14(2(5,6)7,3(8,9)10)4(11,12)13/h1H3 |
| InChIKey | PLVDPEQWNLGHIT-UHFFFAOYSA-N |
| Boiling point | -7.505°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | -31.823°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyltris(Trifluoromethyl)Germane |