Online Database of Chemicals from Around the World

2,3-Difluoro-6-methoxybenzyl Chloride
[CAS 1073435-67-2]

List of Suppliers
Beijing Eagle Sky Pharmatech Co., Ltd. China
www.eagleskypharmatech.com
+86 (10) 5979-9429
8875-5821
+86 (10) 5804-3698
sophia_818@126.com
contact@eagleskypharmatech.com
QQ Chat
Chemical manufacturer since 2009
chemBlink Standard supplier since 2010

Identification
ClassificationOrganic raw materials >> Organic fluorine compound
Name2,3-Difluoro-6-methoxybenzyl Chloride
Synonyms3-(chloromethyl)-1,2-difluoro-4-methoxybenzene
Molecular Structure2,3-Difluoro-6-methoxybenzyl Chloride molecular structure (CAS 1073435-67-2)
Molecular FormulaC8H7ClF2O
Molecular Weight192.59
CAS Registry Number1073435-67-2
EC Number971-704-1
SMILESCOC1=C(C(=C(C=C1)F)F)CCl
Safety Data
Hazard Symbolssymbol symbol   GHS05;GHS07 Danger  Details
Risk StatementsH302-H314-H335  Details
Safety StatementsP260-P261-P264-P270-P271-P280-P301+P317-P301+P330+P331-P302+P361+P354-P304+P340-P305+P354+P338-P316-P319-P321-P330-P363-P403+P233-P405-P501  Details
Hazard Classification
up    Details
HazardClassCategory CodeHazard Statement
Acute toxicityAcute Tox.4H302
Skin corrosionSkin Corr.1BH314
Specific target organ toxicity - single exposureSTOT SE3H335
up Discovery and Applications
2,3-Difluoro-6-methoxybenzyl chloride is an organofluorine compound known for its significant role as an intermediate in organic synthesis. Structurally, it consists of a benzene ring substituted with two fluorine atoms at the 2 and 3 positions, a methoxy group at the 6 position, and a benzyl chloride moiety. This unique substitution pattern endows it with specific reactivity, making it a valuable building block for more complex molecules.

The discovery of 2,3-difluoro-6-methoxybenzyl chloride can be traced back to studies on the functionalization of aromatic rings through electrophilic substitution. Fluorinated aromatics gained prominence due to the growing interest in pharmaceuticals and agrochemicals, where the presence of fluorine atoms can enhance biological activity and metabolic stability. The incorporation of a methoxy group further modulates the electronic properties of the ring, influencing the reactivity of the molecule.

The most common synthesis method for 2,3-difluoro-6-methoxybenzyl chloride involves the chloromethylation of 2,3-difluoro-6-methoxytoluene. This reaction typically employs formaldehyde and hydrochloric acid in the presence of a Lewis acid catalyst such as zinc chloride. The process requires careful control of reaction conditions to ensure selective chloromethylation while minimizing side reactions. After chloromethylation, the benzyl chloride derivative is purified by standard techniques such as distillation or crystallization.

In terms of application, 2,3-difluoro-6-methoxybenzyl chloride serves as a crucial intermediate in the synthesis of pharmaceutical agents, particularly those targeting neurological or cardiovascular conditions. Its fluorine atoms enhance the bioavailability and receptor-binding affinity of the final compounds. Additionally, this molecule is used in agrochemical development, where fluorinated benzyl derivatives improve the efficacy and persistence of pesticides and herbicides. The versatility of this compound lies in its ability to undergo further functionalization, including nucleophilic substitution or coupling reactions, facilitating the construction of complex molecular scaffolds.

Research continues to explore novel derivatives of 2,3-difluoro-6-methoxybenzyl chloride for potential applications in medicinal chemistry and materials science. Its importance as a synthetic intermediate underscores the ongoing demand for precision fluorination techniques in modern chemical synthesis.
Market Analysis Reports
Related Products
3-(Difluorometh...  2,6-Difluoro-4-...  4,5-Difluoro-2-...  2,6-Difluoro-3-...  2,3-Difluoro-4-...  4-(Difluorometh...  3-(Difluorometh...  2-(Difluorometh...  3,5-Difluoro-2-...  2,6-Difluoro-4-...  [2-(Difluoromet...  [4-(Difluoromet...  (5E)-5-[4-(Difl...  N-[4-(Difluorom...  4-(Difluorometh...  4-(Difluorometh...  (1R,3S,4S)-3-[6...  3,4-Difluoro-5-...  2,3-Difluoro-5-...  2,6-Difluoro-4-...