| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Fluorochem Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 4-(Difluoromethoxy)Biphenyl |
|---|---|
| Synonyms | 1,1'-BIPHENYL,4-(DIFLUOROMETHOXY)-; 4-Difluoromethoxy-biphenyl |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10F2O |
| Molecular Weight | 220.21 |
| CAS Registry Number | 175838-98-9 |
| SMILES | c1ccc(cc1)c2ccc(cc2)OC(F)F |
| InChI | 1S/C13H10F2O/c14-13(15)16-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9,13H |
| InChIKey | QPQOBTBELMMKJE-UHFFFAOYSA-N |
| Density | 1.159g/cm3 (Cal.) |
|---|---|
| Boiling point | 296.694°C at 760 mmHg (Cal.) |
| Flash point | 140.849°C (Cal.) |
| Refractive index | 1.521 (Cal.) |
| (1) | Zheng Ji. Chlorodifluoromethyl phenyl sulfone: a novel non-ozone-depleting substance-based difluorocarbene reagent for O- and N-difluoromethylations, Chemical Communications, 2007 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-(Difluoromethoxy)Biphenyl |