Online Database of Chemicals from Around the World
|
CAS#: 108031-80-7 Product: (4R,4'S)-4,4'-Oxybis(1,10,10-Trimethyl-3-Oxatricyclo[5.2.1.02,6]Decane) No suppilers available for the product. |
| Name | (4R,4'S)-4,4'-Oxybis(1,10,10-Trimethyl-3-Oxatricyclo[5.2.1.02,6]Decane) |
|---|---|
| Synonyms | (2S)-(-)- |
| Molecular Structure | ![CAS#: 108031-80-7， (4R,4'S)-4,4'-Oxybis(1,10,10-Trimethyl-3-Oxatricyclo[5.2.1.0<Sup>2,6</Sup>]Decane)](/moreStructures/108031-80-7.gif) |
| Molecular Formula | C24H38O3 |
| Molecular Weight | 374.56 |
| CAS Registry Number | 108031-80-7 |
| SMILES | CC6(C)C1CCC6(C)C2O[C@@H](CC12)O[C@H]3CC4C5CCC(C)(C4O3)C5(C)C |
| InChI | 1S/C24H38O3/c1-21(2)15-7-9-23(21,5)19-13(15)11-17(26-19)25-18-12-14-16-8-10-24(6,20(14)27-18)22(16,3)4/h13-20H,7-12H2,1-6H3/t13?,14?,15?,16?,17-,18+,19?,20?,23?,24? |
| InChIKey | VUDXCBLBKXFCNA-WADPFCMJSA-N |
| Density | 1.12g/cm3 (Cal.) |
|---|---|
| Boiling point | 435.884°C at 760 mmHg (Cal.) |
| Flash point | 148.712°C (Cal.) |
| Refractive index | 1.546 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4R,4'S)-4,4'-Oxybis(1,10,10-Trimethyl-3-Oxatricyclo[5.2.1.02,6]Decane) |