|
CAS#: 31242-93-0 Product: 1,1'-Oxybis(2,4,6-Trichlorobenzene) No suppilers available for the product. |
| Name | 1,1'-Oxybis(2,4,6-Trichlorobenzene) |
|---|---|
| Synonyms | Benzene, 1,1'-oxybis-, hexachloro deriv. (9CI); Chlorinated diphenyl oxide; Ether, hexachlorophenyl |
| Molecular Structure | ![]() |
| Molecular Formula | C12H4Cl6O |
| Molecular Weight | 376.88 |
| CAS Registry Number | 31242-93-0 |
| SMILES | Clc2cc(Cl)cc(Cl)c2Oc1c(Cl)cc(Cl)cc1Cl |
| InChI | 1S/C12H4Cl6O/c13-5-1-7(15)11(8(16)2-5)19-12-9(17)3-6(14)4-10(12)18/h1-4H |
| InChIKey | UPFQVVDUHJVSON-UHFFFAOYSA-N |
| Density | 1.626g/cm3 (Cal.) |
|---|---|
| Boiling point | 361.221°C at 760 mmHg (Cal.) |
| Flash point | 122.501°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1'-Oxybis(2,4,6-Trichlorobenzene) |