Online Database of Chemicals from Around the World
| Name | 4-(4-Aminophenyl)-2-Bromoaniline |
|---|---|
| Synonyms | 4-(4-Aminophenyl)-2-Bromo-Aniline; [4-(4-Aminophenyl)-2-Bromo-Phenyl]Amine; 4-13-00-00386 (Beilstein Handbook Reference) |
| Molecular Structure |  |
| Molecular Formula | C12H11BrN2 |
| Molecular Weight | 263.14 |
| CAS Registry Number | 108238-11-5 |
| SMILES | C1=C(Br)C(=CC=C1C2=CC=C(N)C=C2)N |
| InChI | 1S/C12H11BrN2/c13-11-7-9(3-6-12(11)15)8-1-4-10(14)5-2-8/h1-7H,14-15H2 |
| InChIKey | HRDVSBWJVVGOAT-UHFFFAOYSA-N |
| Density | 1.5g/cm3 (Cal.) |
|---|---|
| Boiling point | 378.934°C at 760 mmHg (Cal.) |
| Flash point | 182.973°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(4-Aminophenyl)-2-Bromoaniline |
