Online Database of Chemicals from Around the World
|
CAS#: 108736-00-1 Product: 7-Methylpyrido(4,3-c)psoralen No suppilers available for the product. |
| Name | 7-Methylpyrido(4,3-c)psoralen |
|---|---|
| Synonyms | 5H-Furo(3',2':6,7)(1)Benzopyrano(4,3-C)Pyridin-5-One, 7-Methyl-; 7-Methylpyrido(4,3-C)Psoralen |
| Molecular Structure |  |
| Molecular Formula | C15H9NO3 |
| Molecular Weight | 251.24 |
| CAS Registry Number | 108736-00-1 |
| SMILES | C2=C1C=COC1=C(C4=C2C3=CN=CC=C3C(O4)=O)C |
| InChI | 1S/C15H9NO3/c1-8-13-9(3-5-18-13)6-11-12-7-16-4-2-10(12)15(17)19-14(8)11/h2-7H,1H3 |
| InChIKey | TZPCGFWNXSOOTQ-UHFFFAOYSA-N |
| Density | 1.396g/cm3 (Cal.) |
|---|---|
| Boiling point | 457.104°C at 760 mmHg (Cal.) |
| Flash point | 230.249°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Methylpyrido(4,3-c)psoralen |