Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 3-Methyl-Pyrido[3,4-b]Pyrazine-5,7-Diamine |
|---|---|
| Synonyms | (7-Amino-3-Methyl-Pyrido[4,3-B]Pyrazin-5-Yl)Amine; Nsc76788 |
| Molecular Structure | ![CAS#: 74023-40-8， 3-Methyl-Pyrido[3,4-b]Pyrazine-5,7-Diamine](/moreStructures/74023-40-8.gif) |
| Molecular Formula | C8H9N5 |
| Molecular Weight | 175.19 |
| CAS Registry Number | 74023-40-8 |
| SMILES | C1=C(N=C(C2=C1N=CC(=N2)C)N)N |
| InChI | 1S/C8H9N5/c1-4-3-11-5-2-6(9)13-8(10)7(5)12-4/h2-3H,1H3,(H4,9,10,13) |
| InChIKey | ZQLOTNQYQYLGHR-UHFFFAOYSA-N |
| Density | 1.412g/cm3 (Cal.) |
|---|---|
| Boiling point | 394.963°C at 760 mmHg (Cal.) |
| Flash point | 221.265°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methyl-Pyrido[3,4-b]Pyrazine-5,7-Diamine |