Online Database of Chemicals from Around the World
|
CAS#: 109278-36-6 Product: Hydroxydihydrosterigmatocystin No suppilers available for the product. |
| Name | Hydroxydihydrosterigmatocystin |
|---|---|
| Synonyms | 1,2,3A,12C-Tetrahydro-2,8-Dihydroxy-6-Methoxy-7H-Furo(3',2':4,5)Furo(2,3-C)Xanthen-7-One (2R-(2Alpha,3Abeta,12Cbeta))-; 17-Dhst; 17-Hydroxy-16,17-Dihydrosterigmatocystin |
| Molecular Structure |  |
| Molecular Formula | C18H14O7 |
| Molecular Weight | 342.30 |
| CAS Registry Number | 109278-36-6 |
| SMILES | C1=CC(=C2C(=C1)OC3=C(C2=O)C(=CC5=C3C4CC(OC4O5)O)OC)O |
| InChI | 1S/C18H14O7/c1-22-10-6-11-13(7-5-12(20)25-18(7)24-11)17-15(10)16(21)14-8(19)3-2-4-9(14)23-17/h2-4,6-7,12,18-20H,5H2,1H3 |
| InChIKey | WRUJLZVXYZPNCL-UHFFFAOYSA-N |
| Density | 1.567g/cm3 (Cal.) |
|---|---|
| Boiling point | 615.973°C at 760 mmHg (Cal.) |
| Flash point | 231.62°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Hydroxydihydrosterigmatocystin |