Online Database of Chemicals from Around the World
|
CAS#: 18529-67-4 Product: 7-Hydroxydihydrotestosterone No suppilers available for the product. |
| Name | 7-Hydroxydihydrotestosterone |
|---|---|
| Synonyms | 7-Hydroxy-Dihydrotestosterone; 7-Hydroxydihydrotestosterone; 7Alpha,17Beta-Dihydroxy-5Alpha-Androstan-3-One |
| Molecular Structure |  |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.44 |
| CAS Registry Number | 18529-67-4 |
| SMILES | [C@H]12CC(CC[C@@]1([C@@H]4[C@@H]([C@@H](C2)O)[C@@H]3CC[C@@H]([C@@]3(C)CC4)O)C)=O |
| InChI | 1S/C19H30O3/c1-18-7-5-12(20)9-11(18)10-15(21)17-13-3-4-16(22)19(13,2)8-6-14(17)18/h11,13-17,21-22H,3-10H2,1-2H3/t11-,13+,14+,15-,16+,17+,18+,19+/m1/s1 |
| InChIKey | AYOPWAMPNDGXSM-DJHVUUHHSA-N |
| Density | 1.158g/cm3 (Cal.) |
|---|---|
| Boiling point | 454.743°C at 760 mmHg (Cal.) |
| Flash point | 242.945°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Hydroxydihydrotestosterone |