| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() | www.purerechem.com | |||
![]() | +86 (551) 6288-8437 +86 18096409024 | |||
![]() | info@purerechem.com | |||
![]() | QQ Chat | |||
![]() | Skype Chat | |||
![]() | WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Bendamustine Impurity 4 |
|---|---|
| Synonyms | Dihydroxy Bendamustine;4-[5-[bis(2-hydroxyethyl)amino]-1-methylbenzimidazol-2-yl]butanoic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.37 |
| CAS Registry Number | 109882-30-6 |
| EC Number | 807-634-4 |
| SMILES | CN1C2=C(C=C(C=C2)N(CCO)CCO)N=C1CCCC(=O)O |
| Solubility | 2146 mg/L (25 °C water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.606, Calc.* |
| Melting point | 244.22 °C |
| Boiling Point | 567.70 °C, 634.4±55.0 °C (760 mmHg), Calc.* |
| Flash Point | 337.5±31.5 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H301-H340-H350-H360-H372 Details | ||||||||||||||||||||||||
| Safety Statements | H301-H340-H350-H360-H372 Details | ||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||
| |||||||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for Bendamustine Impurity 4 |