Online Database of Chemicals from Around the World
| Name | 1,2,3,7,8,9-Hexabromooxanthrene |
|---|---|
| Synonyms | 1,2,3,7,8,9-Hexabromodibenzo(B,E)(1,4)Dioxin; Dibenzo(B,E)(1,4)Dioxin, 1,2,3,7,8,9-Hexabromo- |
| Molecular Structure |  |
| Molecular Formula | C12H2Br6O2 |
| Molecular Weight | 657.57 |
| CAS Registry Number | 110999-46-7 |
| SMILES | C1=C2C(=C(C(=C1Br)Br)Br)OC3=C(O2)C=C(C(=C3Br)Br)Br |
| InChI | 1S/C12H2Br6O2/c13-3-1-5-11(9(17)7(3)15)20-12-6(19-5)2-4(14)8(16)10(12)18/h1-2H |
| InChIKey | BQLIEPWVZAEMQP-UHFFFAOYSA-N |
| Density | 2.681g/cm3 (Cal.) |
|---|---|
| Boiling point | 545.656°C at 760 mmHg (Cal.) |
| Flash point | 229.556°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,7,8,9-Hexabromooxanthrene |
