Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Hexabromonaphthalene |
|---|---|
| Synonyms | Hexabromonaphthalene; Hexabrominated Naphthalene |
| Molecular Structure |  |
| Molecular Formula | C10H2Br6 |
| Molecular Weight | 601.55 |
| CAS Registry Number | 56480-06-9 |
| EINECS | 260-214-7 |
| SMILES | C1=C(C(=C(C2=C1C(=CC(=C2Br)Br)Br)Br)Br)Br |
| InChI | 1S/C10H2Br6/c11-4-2-6(13)8(14)7-3(4)1-5(12)9(15)10(7)16/h1-2H |
| InChIKey | NOXBHKAVWHWFDR-UHFFFAOYSA-N |
| Density | 2.726g/cm3 (Cal.) |
|---|---|
| Boiling point | 514.259°C at 760 mmHg (Cal.) |
| Flash point | 254.593°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Hexabromonaphthalene |