Online Database of Chemicals from Around the World
| Name | 1-Benzyl-2,3-Piperidinedione |
|---|---|
| Synonyms | 1-Benzyl-2,3-piperidindion; 1-Benzyl-2,3-piperidinedione; 1-Benzyl-2,3-pipéridinedione |
| Molecular Structure |  |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 |
| CAS Registry Number | 111492-69-4 |
| SMILES | c1ccc(cc1)CN2CCCC(=O)C2=O |
| InChI | 1S/C12H13NO2/c14-11-7-4-8-13(12(11)15)9-10-5-2-1-3-6-10/h1-3,5-6H,4,7-9H2 |
| InChIKey | YXCASZOHZLUBIF-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 341.9±35.0°C at 760 mmHg (Cal.) |
| Flash point | 152.5±18.3°C (Cal.) |
| Refractive index | 1.578 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Benzyl-2,3-Piperidinedione |
