|
CAS#: 112440-50-3 Product: (2E)-2,3-Bis(2,4,5-Trimethyl-3-Thienyl)-2-Butenedinitrile No suppilers available for the product. |
| Name | (2E)-2,3-Bis(2,4,5-Trimethyl-3-Thienyl)-2-Butenedinitrile |
|---|---|
| Synonyms | trans-1,2-Dicyano-1,2-bis(2,4,5-trimethyl-3-thienyl)ethene |
| Molecular Structure | ![]() |
| Molecular Formula | C18H18N2S2 |
| Molecular Weight | 326.48 |
| CAS Registry Number | 112440-50-3 |
| SMILES | Cc2c(C(/C#N)=C(\C#N)c1c(C)c(C)sc1C)c(C)sc2C |
| InChI | 1S/C18H18N2S2/c1-9-11(3)21-13(5)17(9)15(7-19)16(8-20)18-10(2)12(4)22-14(18)6/h1-6H3/b16-15+ |
| InChIKey | AYNDKKQQUZPETC-FOCLMDBBSA-N |
| Density | 1.184g/cm3 (Cal.) |
|---|---|
| Melting point | 167°C (Expl.) |
| Boiling point | 441.512°C at 760 mmHg (Cal.) |
| Flash point | 220.819°C (Cal.) |
| Refractive index | 1.611 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (2E)-2,3-Bis(2,4,5-Trimethyl-3-Thienyl)-2-Butenedinitrile |