|
CAS#: 19159-68-3 Product: (E)-Bis(2,4,6-Trinitrophenyl)Diazene No suppilers available for the product. |
| Name | (E)-Bis(2,4,6-Trinitrophenyl)Diazene |
|---|---|
| Synonyms | 2,2',4,4',6,6'-Hexanitroazobenzene; AZOBENZENE, 2,2',4,4',6,6'-HEXANITRO-; benzene, hexanitroazo- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H4N8O12 |
| Molecular Weight | 452.21 |
| CAS Registry Number | 19159-68-3 |
| EINECS | 242-850-7 |
| SMILES | [O-][N+](=O)c2c(/N=N/c1c(cc(cc1[N+]([O-])=O)[N+]([O-])=O)[N+]([O-])=O)c([N+]([O-])=O)cc([N+]([O-])=O)c2 |
| InChI | 1S/C12H4N8O12/c21-15(22)5-1-7(17(25)26)11(8(2-5)18(27)28)13-14-12-9(19(29)30)3-6(16(23)24)4-10(12)20(31)32/h1-4H/b14-13+ |
| InChIKey | PSDIVOYKWCKHLG-BUHFOSPRSA-N |
| Density | 2.152g/cm3 (Cal.) |
|---|---|
| Boiling point | 699.516°C at 760 mmHg (Cal.) |
| Flash point | 376.854°C (Cal.) |
| Refractive index | 1.837 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (E)-Bis(2,4,6-Trinitrophenyl)Diazene |