|
CAS#: 113411-16-8 Product: 1-(3,5-Dichloro-2,6-Dihydroxy-4-Methoxyphenyl)Pentan-1-One No suppilers available for the product. |
| Name | 1-(3,5-Dichloro-2,6-Dihydroxy-4-Methoxyphenyl)Pentan-1-One |
|---|---|
| Synonyms | 1-(3,5-Dichloro-2,6-Dihydroxy-4-Methoxy-Phenyl)Pentan-1-One; 1-(3,5-Dichloro-2,6-Dihydroxy-4-Methoxyphenyl-)-1-Pentanone; 1-Pentanone, 1-(3,5-Dichloro-2,6-Dihydroxy-4-Methoxyphenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H14Cl2O4 |
| Molecular Weight | 293.15 |
| CAS Registry Number | 113411-16-8 |
| SMILES | C(C(=O)C1=C(O)C(=C(OC)C(=C1O)Cl)Cl)CCC |
| InChI | 1S/C12H14Cl2O4/c1-3-4-5-6(15)7-10(16)8(13)12(18-2)9(14)11(7)17/h16-17H,3-5H2,1-2H3 |
| InChIKey | VZEUMRXJWIAEOK-UHFFFAOYSA-N |
| Density | 1.362g/cm3 (Cal.) |
|---|---|
| Boiling point | 423.273°C at 760 mmHg (Cal.) |
| Flash point | 209.788°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(3,5-Dichloro-2,6-Dihydroxy-4-Methoxyphenyl)Pentan-1-One |