Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (1R,2S)-2-Fluorocyclohexyl Thiocyanate |
|---|---|
| Synonyms | (1S,2R)-1-fluoro-2-thiocyanatocyclohexane |
| Molecular Structure |  |
| Molecular Formula | C7H10FNS |
| Molecular Weight | 159.22 |
| CAS Registry Number | 113487-46-0 |
| SMILES | C1CC[C@H]([C@H](C1)F)SC#N |
| InChI | 1S/C7H10FNS/c8-6-3-1-2-4-7(6)10-5-9/h6-7H,1-4H2/t6-,7+/m0/s1 |
| InChIKey | UNDRPNDIQAFDIJ-NKWVEPMBSA-N |
| Density | 1.136g/cm3 (Cal.) |
|---|---|
| Boiling point | 248.975°C at 760 mmHg (Cal.) |
| Flash point | 104.377°C (Cal.) |
| Refractive index | 1.489 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1R,2S)-2-Fluorocyclohexyl Thiocyanate |