Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-[(1S,2S)-2-Fluorocyclohexyl]Ethanol |
|---|---|
| Synonyms | 2-((1S,2S)-2-fluorocyclohexyl)ethanol |
| Molecular Structure | ![CAS#: 161618-48-0， 2-[(1S,2S)-2-Fluorocyclohexyl]Ethanol](/moreStructures/161618-48-0.gif) |
| Molecular Formula | C8H15FO |
| Molecular Weight | 146.20 |
| CAS Registry Number | 161618-48-0 |
| SMILES | C1CC[C@@H]([C@@H](C1)CCO)F |
| InChI | 1S/C8H15FO/c9-8-4-2-1-3-7(8)5-6-10/h7-8,10H,1-6H2/t7-,8-/m0/s1 |
| InChIKey | JYYCNMZHMPKCNC-YUMQZZPRSA-N |
| Density | 1g/cm3 (Cal.) |
|---|---|
| Boiling point | 207.374°C at 760 mmHg (Cal.) |
| Flash point | 102.833°C (Cal.) |
| Refractive index | 1.441 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(1S,2S)-2-Fluorocyclohexyl]Ethanol |