Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| CiVentiChem - Simple Solutions for Complex Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (919) 678-0702 | |||
|
sales@cvchem.com | |||
| Chemical manufacturer since 1994 | ||||
| Name | 4-Penten-1-Yl 2,3,4,6-Tetra-O-Benzyl-D-Glucopyranoside |
|---|---|
| Synonyms | Pent-4-enyl-2,3,46-tetra-O-benzyloxy-D-Glucopyranoside |
| Molecular Structure |  |
| Molecular Formula | C39H44O6 |
| Molecular Weight | 608.76 |
| CAS Registry Number | 113533-73-6 |
| SMILES | C=CCCCOC5O[C@H](COCc1ccccc1)[C@@H](OCc2ccccc2)[C@H](OCc3ccccc3)[C@H]5OCc4ccccc4 |
| InChI | 1S/C39H44O6/c1-2-3-16-25-41-39-38(44-29-34-23-14-7-15-24-34)37(43-28-33-21-12-6-13-22-33)36(42-27-32-19-10-5-11-20-32)35(45-39)30-40-26-31-17-8-4-9-18-31/h2,4-15,17-24,35-39H,1,3,16,25-30H2/t35-,36-,37+,38-,39?/m1/s1 |
| InChIKey | UJKZBFGKKCLGDY-WVTZLKINSA-N |
| Density | 1.156g/cm3 (Cal.) |
|---|---|
| Boiling point | 696.813°C at 760 mmHg (Cal.) |
| Flash point | 256.224°C (Cal.) |
| Refractive index | 1.592 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Penten-1-Yl 2,3,4,6-Tetra-O-Benzyl-D-Glucopyranoside |