Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| CiVentiChem - Simple Solutions for Complex Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (919) 678-0702 | |||
|
sales@cvchem.com | |||
| Chemical manufacturer since 1994 | ||||
| Name | 4-Penten-1-Yl 2,3,4-Tri-O-Benzyl-D-Glucopyranoside |
|---|---|
| Synonyms | Pent-4-enyl-2,3,4-tri-O-benzyloxy-D-Gluco pyranoside |
| Molecular Structure |  |
| Molecular Formula | C32H38O6 |
| Molecular Weight | 518.64 |
| CAS Registry Number | 155036-27-4 |
| SMILES | OC[C@H]4OC(OCCCC=C)[C@H](OCc1ccccc1)[C@@H](OCc2ccccc2)[C@@H]4OCc3ccccc3 |
| InChI | 1S/C32H38O6/c1-2-3-13-20-34-32-31(37-24-27-18-11-6-12-19-27)30(36-23-26-16-9-5-10-17-26)29(28(21-33)38-32)35-22-25-14-7-4-8-15-25/h2,4-12,14-19,28-33H,1,3,13,20-24H2/t28-,29-,30+,31-,32?/m1/s1 |
| InChIKey | IRSAWEJGUXIKAZ-MDKHBBSCSA-N |
| Density | 1.169g/cm3 (Cal.) |
|---|---|
| Boiling point | 635.487°C at 760 mmHg (Cal.) |
| Flash point | 338.13°C (Cal.) |
| Refractive index | 1.585 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Penten-1-Yl 2,3,4-Tri-O-Benzyl-D-Glucopyranoside |