Online Database of Chemicals from Around the World
|
CAS#: 113564-23-1 Product: 11-Deoxytetrodotoxin No suppilers available for the product. |
| Name | 11-Deoxytetrodotoxin |
|---|---|
| Synonyms | Tetrodoxin, 11-Deoxy-, (4Beta)- |
| Molecular Structure |  |
| Molecular Formula | C11H17N3O7 |
| Molecular Weight | 303.27 |
| CAS Registry Number | 113564-23-1 |
| SMILES | [C@@H]14O[C@@]2([C@H]([C@@]3([C@H]([C@H]([C@@]1(O)C)O2)[C@@H](N=C(N3)N)O)C4O)O)O |
| InChI | 1S/C11H17N3O7/c1-9(18)4-2-6(16)13-8(12)14-10(2)3(15)5(9)21-11(19,20-4)7(10)17/h2-7,15-19H,1H3,(H3,12,13,14)/t2-,3?,4-,5+,6+,7+,9+,10-,11+/m1/s1 |
| InChIKey | XXUFXWUHBMGUMY-FDOMXQSUSA-N |
| Density | 2.6g/cm3 (Cal.) |
|---|---|
| Boiling point | 692.1°C at 760 mmHg (Cal.) |
| Flash point | 372.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 11-Deoxytetrodotoxin |